C19H22N6O6 — CID 10202960
[(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate (PubChem CID 10202960) has the molecular formula C19H22N6O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 10202960 |
| Molecular Formula | C19H22N6O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](COC(=O)[C@@H](N)Cc3c[nH]c4ccccc34)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C19H22N6O6/c20-11(5-9-6-22-12-4-2-1-3-10(9)12)19(29)30-7-13-14(26)15(27)18(31-13)25-8-23-17(24-25)16(21)28/h1-4,6,8,11,13-15,18,22,26-27H,5,7,20H2,(H2,21,28)/t11-,13+,14+,15+,18+/m0/s1 |
| InChIKey | LUHOYSHYHGUQSB-BBYLVHEZSA-N |
| XLogP | -1.41 |
| TPSA | 191.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |