C11H12MnN2O2 — CID 159424306
(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;manganese (PubChem CID 159424306) has the molecular formula C11H12MnN2O2 and a molecular weight of 259.17 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;manganese.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;manganese |
|---|---|
| PubChem CID | 159424306 |
| Molecular Formula | C11H12MnN2O2 |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;manganese |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O.[Mn] |
| InChI | InChI=1S/C11H12N2O2.Mn/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;/h1-4,6,9,13H,5,12H2,(H,14,15);/t9-;/m0./s1 |
| InChIKey | LQDQOXRZUDFCOE-FVGYRXGTSA-N |
| XLogP | 1.12 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |