C13H16N2O3 — CID 88778377
acetaldehyde;(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid (PubChem CID 88778377) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is acetaldehyde;(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | acetaldehyde;(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 88778377 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | acetaldehyde;(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC=O.N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O2.C2H4O/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;1-2-3/h1-4,6,9,13H,5,12H2,(H,14,15);2H,1H3/t9-;/m0./s1 |
| InChIKey | GGVFWZBWQCZRNE-FVGYRXGTSA-N |
| XLogP | 1.33 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|