C18H18N2O4Zn — CID 175507605
2-amino-3-(1H-indol-3-yl)propanoic acid;2-hydroxybenzaldehyde;zinc (PubChem CID 175507605) has the molecular formula C18H18N2O4Zn and a molecular weight of 391.74 g/mol. Its IUPAC name is 2-amino-3-(1H-indol-3-yl)propanoic acid;2-hydroxybenzaldehyde;zinc.
| Compound Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;2-hydroxybenzaldehyde;zinc |
|---|---|
| PubChem CID | 175507605 |
| Molecular Formula | C18H18N2O4Zn |
| Molecular Weight | 391.74 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;2-hydroxybenzaldehyde;zinc |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)O.O=Cc1ccccc1O.[Zn] |
| InChI | InChI=1S/C11H12N2O2.C7H6O2.Zn/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;8-5-6-3-1-2-4-7(6)9;/h1-4,6,9,13H,5,12H2,(H,14,15);1-5,9H; |
| InChIKey | BAAGNSZKNJYSIG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.74 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|