C11H14N2O6S — CID 19909490
2-amino-3-(1H-indol-3-yl)propanoic acid;sulfuric acid (PubChem CID 19909490) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-amino-3-(1H-indol-3-yl)propanoic acid;sulfuric acid.
| Compound Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 19909490 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;sulfuric acid |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C11H12N2O2.H2O4S/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;1-5(2,3)4/h1-4,6,9,13H,5,12H2,(H,14,15);(H2,1,2,3,4) |
| InChIKey | CLINFZQBXPTCNW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|