C12H16N2O5S — CID 121440286
(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;methanesulfonic acid (PubChem CID 121440286) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;methanesulfonic acid.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 121440286 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O2.CH4O3S/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;1-5(2,3)4/h1-4,6,9,13H,5,12H2,(H,14,15);1H3,(H,2,3,4)/t9-;/m0./s1 |
| InChIKey | WDPKBRKRDCQOJO-FVGYRXGTSA-N |
| XLogP | 0.63 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|