C15H21N3O2 — CID 139681771
4-aminobutyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate (PubChem CID 139681771) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-aminobutyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate.
| Compound Name | 4-aminobutyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 139681771 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-aminobutyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
| SMILES | NCCCCOC(=O)[C@@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H21N3O2/c16-7-3-4-8-20-15(19)13(17)9-11-10-18-14-6-2-1-5-12(11)14/h1-2,5-6,10,13,18H,3-4,7-9,16-17H2/t13-/m0/s1 |
| InChIKey | QSBOEEOLSRACSP-ZDUSSCGKSA-N |
| XLogP | 1.32 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|