C23H26N2O4 — CID 155115353
benzyl 5-[2-amino-3-(1H-indol-3-yl)propanoyl]oxypentanoate (PubChem CID 155115353) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is benzyl 5-[2-amino-3-(1H-indol-3-yl)propanoyl]oxypentanoate.
| Compound Name | benzyl 5-[2-amino-3-(1H-indol-3-yl)propanoyl]oxypentanoate |
|---|---|
| PubChem CID | 155115353 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | benzyl 5-[2-amino-3-(1H-indol-3-yl)propanoyl]oxypentanoate |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)OCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H26N2O4/c24-20(14-18-15-25-21-11-5-4-10-19(18)21)23(27)28-13-7-6-12-22(26)29-16-17-8-2-1-3-9-17/h1-5,8-11,15,20,25H,6-7,12-14,16,24H2 |
| InChIKey | FRVJPXKZAZHALV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|