C16H22N2O2 — CID 22597671
3-methylbutyl 2-amino-3-(1H-indol-3-yl)propanoate (PubChem CID 22597671) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-methylbutyl 2-amino-3-(1H-indol-3-yl)propanoate.
| Compound Name | 3-methylbutyl 2-amino-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 22597671 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-methylbutyl 2-amino-3-(1H-indol-3-yl)propanoate |
| SMILES | CC(C)CCOC(=O)C(N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H22N2O2/c1-11(2)7-8-20-16(19)14(17)9-12-10-18-15-6-4-3-5-13(12)15/h3-6,10-11,14,18H,7-9,17H2,1-2H3 |
| InChIKey | YDAJZUJBIVDCKZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |