C17H22N2O3 — CID 155622601
[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl] 2-methylpentanoate (PubChem CID 155622601) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(2S)-2-amino-3-(1H-indol-3-yl)propanoyl] 2-methylpentanoate.
| Compound Name | [(2S)-2-amino-3-(1H-indol-3-yl)propanoyl] 2-methylpentanoate |
|---|---|
| PubChem CID | 155622601 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [(2S)-2-amino-3-(1H-indol-3-yl)propanoyl] 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)OC(=O)[C@@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H22N2O3/c1-3-6-11(2)16(20)22-17(21)14(18)9-12-10-19-15-8-5-4-7-13(12)15/h4-5,7-8,10-11,14,19H,3,6,9,18H2,1-2H3/t11?,14-/m0/s1 |
| InChIKey | RGUFQCRLXFISOG-IAXJKZSUSA-N |
| XLogP | 2.54 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|