C17H23N3O3 — CID 54443221
[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl] (2S)-2-amino-4-methylpentanoate (PubChem CID 54443221) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is [(2S)-2-amino-3-(1H-indol-3-yl)propanoyl] (2S)-2-amino-4-methylpentanoate.
| Compound Name | [(2S)-2-amino-3-(1H-indol-3-yl)propanoyl] (2S)-2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 54443221 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | [(2S)-2-amino-3-(1H-indol-3-yl)propanoyl] (2S)-2-amino-4-methylpentanoate |
| SMILES | CC(C)C[C@H](N)C(=O)OC(=O)[C@@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H23N3O3/c1-10(2)7-13(18)16(21)23-17(22)14(19)8-11-9-20-15-6-4-3-5-12(11)15/h3-6,9-10,13-14,20H,7-8,18-19H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | WPPMZMKBQWSLFQ-KBPBESRZSA-N |
| XLogP | 1.48 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|