C18H19ClN2O2 — CID 44629900
benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (PubChem CID 44629900) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride.
| Compound Name | benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 44629900 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| SMILES | Cl.N[C@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H18N2O2.ClH/c19-16(18(21)22-12-13-6-2-1-3-7-13)10-14-11-20-17-9-5-4-8-15(14)17;/h1-9,11,16,20H,10,12,19H2;1H/t16-;/m1./s1 |
| InChIKey | DOKDMGOWZOTZRA-PKLMIRHRSA-N |
| XLogP | 3.20 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |