C24H29N3O3 — CID 174582730
benzyl 2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoate (PubChem CID 174582730) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is benzyl 2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoate.
| Compound Name | benzyl 2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 174582730 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | benzyl 2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H29N3O3/c1-3-16(2)22(24(29)30-15-17-9-5-4-6-10-17)27-23(28)20(25)13-18-14-26-21-12-8-7-11-19(18)21/h4-12,14,16,20,22,26H,3,13,15,25H2,1-2H3,(H,27,28) |
| InChIKey | BBSGVOFUMTXJHA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |