C29H37N5O6 — CID 19948290
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid (PubChem CID 19948290) has the molecular formula C29H37N5O6 and a molecular weight of 551.64 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 19948290 |
| Molecular Formula | C29H37N5O6 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(CO)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H37N5O6/c1-3-17(2)25(29(39)40)34-27(37)23(13-18-9-5-4-6-10-18)32-28(38)24(16-35)33-26(36)21(30)14-19-15-31-22-12-8-7-11-20(19)22/h4-12,15,17,21,23-25,31,35H,3,13-14,16,30H2,1-2H3,(H,32,38)(H,33,36)(H,34,37)(H,39,40) |
| InChIKey | TUNBFWSMONMTIW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |