C23H33N5O7 — CID 19945955
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 19945955) has the molecular formula C23H33N5O7 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 19945955 |
| Molecular Formula | C23H33N5O7 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C23H33N5O7/c1-3-12(2)19(22(33)26-17(10-29)21(32)27-18(11-30)23(34)35)28-20(31)15(24)8-13-9-25-16-7-5-4-6-14(13)16/h4-7,9,12,15,17-19,25,29-30H,3,8,10-11,24H2,1-2H3,(H,26,33)(H,27,32)(H,28,31)(H,34,35) |
| InChIKey | XOOQTOJHXKDWRN-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 206.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |