C26H39N5O6 — CID 19945949
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]-3-methylpentanoic acid (PubChem CID 19945949) has the molecular formula C26H39N5O6 and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 19945949 |
| Molecular Formula | C26H39N5O6 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CO)NC(=O)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(C)CC)C(=O)O |
| InChI | InChI=1S/C26H39N5O6/c1-5-14(3)21(25(35)29-20(13-32)24(34)31-22(26(36)37)15(4)6-2)30-23(33)18(27)11-16-12-28-19-10-8-7-9-17(16)19/h7-10,12,14-15,18,20-22,28,32H,5-6,11,13,27H2,1-4H3,(H,29,35)(H,30,33)(H,31,34)(H,36,37) |
| InChIKey | ZSRUHNCKHGCZBM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |