C23H33N5O5S — CID 19943826
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-methylpentanoyl]amino]propanoic acid (PubChem CID 19943826) has the molecular formula C23H33N5O5S and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-methylpentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19943826 |
| Molecular Formula | C23H33N5O5S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CS)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C23H33N5O5S/c1-4-12(2)19(22(31)26-13(3)23(32)33)28-21(30)18(11-34)27-20(29)16(24)9-14-10-25-17-8-6-5-7-15(14)17/h5-8,10,12-13,16,18-19,25,34H,4,9,11,24H2,1-3H3,(H,26,31)(H,27,29)(H,28,30)(H,32,33) |
| InChIKey | OPRIJIDVMFDMCC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|