C23H33N5O5S2 — CID 18261454
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18261454) has the molecular formula C23H33N5O5S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18261454 |
| Molecular Formula | C23H33N5O5S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CS)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C23H33N5O5S2/c1-3-12(2)19(22(31)27-18(11-35)23(32)33)28-21(30)17(26-20(29)15(24)10-34)8-13-9-25-16-7-5-4-6-14(13)16/h4-7,9,12,15,17-19,25,34-35H,3,8,10-11,24H2,1-2H3,(H,26,29)(H,27,31)(H,28,30)(H,32,33) |
| InChIKey | CDQJINLCUYHHIV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|