C25H37N5O5S — CID 18262413
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 18262413) has the molecular formula C25H37N5O5S and a molecular weight of 519.67 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18262413 |
| Molecular Formula | C25H37N5O5S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(NC(=O)C(N)CS)C(C)C)C(=O)O |
| InChI | InChI=1S/C25H37N5O5S/c1-5-14(4)21(25(34)35)30-23(32)19(10-15-11-27-18-9-7-6-8-16(15)18)28-24(33)20(13(2)3)29-22(31)17(26)12-36/h6-9,11,13-14,17,19-21,27,36H,5,10,12,26H2,1-4H3,(H,28,33)(H,29,31)(H,30,32)(H,34,35) |
| InChIKey | LESHTXAJLNILOS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|