C22H31N5O6S — CID 18262419
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18262419) has the molecular formula C22H31N5O6S and a molecular weight of 493.59 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18262419 |
| Molecular Formula | C22H31N5O6S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C22H31N5O6S/c1-11(2)18(27-19(29)14(23)10-34)21(31)25-16(20(30)26-17(9-28)22(32)33)7-12-8-24-15-6-4-3-5-13(12)15/h3-6,8,11,14,16-18,24,28,34H,7,9-10,23H2,1-2H3,(H,25,31)(H,26,30)(H,27,29)(H,32,33) |
| InChIKey | UQDGVLGHUUHQFE-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|