C31H38N6O5S — CID 19945984
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 19945984) has the molecular formula C31H38N6O5S and a molecular weight of 606.75 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19945984 |
| Molecular Formula | C31H38N6O5S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C31H38N6O5S/c1-3-17(2)27(37-28(38)22(32)12-18-14-33-23-10-6-4-8-20(18)23)30(40)35-25(29(39)36-26(16-43)31(41)42)13-19-15-34-24-11-7-5-9-21(19)24/h4-11,14-15,17,22,25-27,33-34,43H,3,12-13,16,32H2,1-2H3,(H,35,40)(H,36,39)(H,37,38)(H,41,42) |
| InChIKey | BMXYUNNRXHNOCY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 182.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|