C26H35N7O5S — CID 18258422
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18258422) has the molecular formula C26H35N7O5S and a molecular weight of 557.68 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18258422 |
| Molecular Formula | C26H35N7O5S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C26H35N7O5S/c1-3-14(2)22(33-23(34)18(27)12-39)25(36)31-20(8-15-10-29-19-7-5-4-6-17(15)19)24(35)32-21(26(37)38)9-16-11-28-13-30-16/h4-7,10-11,13-14,18,20-22,29,39H,3,8-9,12,27H2,1-2H3,(H,28,30)(H,31,36)(H,32,35)(H,33,34)(H,37,38) |
| InChIKey | KJGIFEJBTUCASU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 195.09 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|