C20H22N2O2 — CID 10041814
(3,5-dimethylphenyl)methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate (PubChem CID 10041814) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate.
| Compound Name | (3,5-dimethylphenyl)methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 10041814 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (3,5-dimethylphenyl)methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
| SMILES | Cc1cc(C)cc(COC(=O)[C@@H](N)Cc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C20H22N2O2/c1-13-7-14(2)9-15(8-13)12-24-20(23)18(21)10-16-11-22-19-6-4-3-5-17(16)19/h3-9,11,18,22H,10,12,21H2,1-2H3/t18-/m0/s1 |
| InChIKey | RGUDXLHTEUZZSX-SFHVURJKSA-N |
| XLogP | 3.40 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |