C22H23NO2 — CID 10314783
(3,5-dimethylphenyl)methyl (2S)-2-amino-3-naphthalen-1-ylpropanoate (PubChem CID 10314783) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl (2S)-2-amino-3-naphthalen-1-ylpropanoate.
| Compound Name | (3,5-dimethylphenyl)methyl (2S)-2-amino-3-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 10314783 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (3,5-dimethylphenyl)methyl (2S)-2-amino-3-naphthalen-1-ylpropanoate |
| SMILES | Cc1cc(C)cc(COC(=O)[C@@H](N)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H23NO2/c1-15-10-16(2)12-17(11-15)14-25-22(24)21(23)13-19-8-5-7-18-6-3-4-9-20(18)19/h3-12,21H,13-14,23H2,1-2H3/t21-/m0/s1 |
| InChIKey | SVVDBUWXHIJQEW-NRFANRHFSA-N |
| XLogP | 4.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |