C21H22N2O — CID 70832631
(2R)-2-amino-3-naphthalen-1-yl-N-(2-phenylethyl)propanamide (PubChem CID 70832631) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is (2R)-2-amino-3-naphthalen-1-yl-N-(2-phenylethyl)propanamide.
| Compound Name | (2R)-2-amino-3-naphthalen-1-yl-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 70832631 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (2R)-2-amino-3-naphthalen-1-yl-N-(2-phenylethyl)propanamide |
| SMILES | N[C@H](Cc1cccc2ccccc12)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H22N2O/c22-20(21(24)23-14-13-16-7-2-1-3-8-16)15-18-11-6-10-17-9-4-5-12-19(17)18/h1-12,20H,13-15,22H2,(H,23,24)/t20-/m1/s1 |
| InChIKey | DPNLJPSNJUWKGA-HXUWFJFHSA-N |
| XLogP | 3.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |