C22H22ClNO — CID 100508937
(2S)-N-[2-(4-chlorophenyl)ethyl]-2-methyl-3-naphthalen-1-ylpropanamide (PubChem CID 100508937) has the molecular formula C22H22ClNO and a molecular weight of 351.88 g/mol. Its IUPAC name is (2S)-N-[2-(4-chlorophenyl)ethyl]-2-methyl-3-naphthalen-1-ylpropanamide.
| Compound Name | (2S)-N-[2-(4-chlorophenyl)ethyl]-2-methyl-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 100508937 |
| Molecular Formula | C22H22ClNO |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (2S)-N-[2-(4-chlorophenyl)ethyl]-2-methyl-3-naphthalen-1-ylpropanamide |
| SMILES | C[C@@H](Cc1cccc2ccccc12)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClNO/c1-16(15-19-7-4-6-18-5-2-3-8-21(18)19)22(25)24-14-13-17-9-11-20(23)12-10-17/h2-12,16H,13-15H2,1H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | NOTKDWYAKGUWRJ-INIZCTEOSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |