C30H29ClN2O2 — CID 155427764
N-[(2S)-4-(4-chlorophenyl)-1-oxo-1-(3-phenylpropylamino)butan-2-yl]naphthalene-1-carboxamide (PubChem CID 155427764) has the molecular formula C30H29ClN2O2 and a molecular weight of 485.03 g/mol. Its IUPAC name is N-[(2S)-4-(4-chlorophenyl)-1-oxo-1-(3-phenylpropylamino)butan-2-yl]naphthalene-1-carboxamide.
| Compound Name | N-[(2S)-4-(4-chlorophenyl)-1-oxo-1-(3-phenylpropylamino)butan-2-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 155427764 |
| Molecular Formula | C30H29ClN2O2 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-[(2S)-4-(4-chlorophenyl)-1-oxo-1-(3-phenylpropylamino)butan-2-yl]naphthalene-1-carboxamide |
| SMILES | O=C(N[C@@H](CCc1ccc(Cl)cc1)C(=O)NCCCc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H29ClN2O2/c31-25-18-15-23(16-19-25)17-20-28(30(35)32-21-7-10-22-8-2-1-3-9-22)33-29(34)27-14-6-12-24-11-4-5-13-26(24)27/h1-6,8-9,11-16,18-19,28H,7,10,17,20-21H2,(H,32,35)(H,33,34)/t28-/m0/s1 |
| InChIKey | GNCSFPCPAGAMBO-NDEPHWFRSA-N |
| XLogP | 5.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|