C23H24ClNO2 — CID 43909206
N-[3-(4-chlorophenyl)propyl]-2-naphthalen-1-yloxybutanamide (PubChem CID 43909206) has the molecular formula C23H24ClNO2 and a molecular weight of 381.90 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)propyl]-2-naphthalen-1-yloxybutanamide.
| Compound Name | N-[3-(4-chlorophenyl)propyl]-2-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 43909206 |
| Molecular Formula | C23H24ClNO2 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[3-(4-chlorophenyl)propyl]-2-naphthalen-1-yloxybutanamide |
| SMILES | CCC(Oc1cccc2ccccc12)C(=O)NCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClNO2/c1-2-21(27-22-11-5-9-18-8-3-4-10-20(18)22)23(26)25-16-6-7-17-12-14-19(24)15-13-17/h3-5,8-15,21H,2,6-7,16H2,1H3,(H,25,26) |
| InChIKey | URTSXTVLUOXAAW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|