C25H29NO2 — CID 94027047
(2R)-2-naphthalen-1-yloxy-N-[2-(4-propan-2-ylphenyl)ethyl]butanamide (PubChem CID 94027047) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (2R)-2-naphthalen-1-yloxy-N-[2-(4-propan-2-ylphenyl)ethyl]butanamide.
| Compound Name | (2R)-2-naphthalen-1-yloxy-N-[2-(4-propan-2-ylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 94027047 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2R)-2-naphthalen-1-yloxy-N-[2-(4-propan-2-ylphenyl)ethyl]butanamide |
| SMILES | CC[C@@H](Oc1cccc2ccccc12)C(=O)NCCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C25H29NO2/c1-4-23(28-24-11-7-9-21-8-5-6-10-22(21)24)25(27)26-17-16-19-12-14-20(15-13-19)18(2)3/h5-15,18,23H,4,16-17H2,1-3H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | HNBLUKLCRSBWOV-HSZRJFAPSA-N |
| XLogP | 5.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |