C19H21Cl2NO2 — CID 132762013
2-(2-chlorophenoxy)-N-[3-(4-chlorophenyl)propyl]butanamide (PubChem CID 132762013) has the molecular formula C19H21Cl2NO2 and a molecular weight of 366.29 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[3-(4-chlorophenyl)propyl]butanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[3-(4-chlorophenyl)propyl]butanamide |
|---|---|
| PubChem CID | 132762013 |
| Molecular Formula | C19H21Cl2NO2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[3-(4-chlorophenyl)propyl]butanamide |
| SMILES | CCC(Oc1ccccc1Cl)C(=O)NCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2NO2/c1-2-17(24-18-8-4-3-7-16(18)21)19(23)22-13-5-6-14-9-11-15(20)12-10-14/h3-4,7-12,17H,2,5-6,13H2,1H3,(H,22,23) |
| InChIKey | INQOWLRNPWIFBN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|