C21H26ClNO4 — CID 132659512
2-(2-chlorophenoxy)-N-[3-(3,4-dimethoxyphenyl)propyl]butanamide (PubChem CID 132659512) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[3-(3,4-dimethoxyphenyl)propyl]butanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[3-(3,4-dimethoxyphenyl)propyl]butanamide |
|---|---|
| PubChem CID | 132659512 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[3-(3,4-dimethoxyphenyl)propyl]butanamide |
| SMILES | CCC(Oc1ccccc1Cl)C(=O)NCCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H26ClNO4/c1-4-17(27-18-10-6-5-9-16(18)22)21(24)23-13-7-8-15-11-12-19(25-2)20(14-15)26-3/h5-6,9-12,14,17H,4,7-8,13H2,1-3H3,(H,23,24) |
| InChIKey | PCBYMGAJSDJJOS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|