C25H33NO4 — CID 133201702
N-[3-(3,4-dimethoxyphenyl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 133201702) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 133201702 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)CCCC2)C(=O)NCCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H33NO4/c1-4-22(30-21-13-12-19-9-5-6-10-20(19)17-21)25(27)26-15-7-8-18-11-14-23(28-2)24(16-18)29-3/h11-14,16-17,22H,4-10,15H2,1-3H3,(H,26,27) |
| InChIKey | HMRBAXUMLFPJLC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|