C19H29NO2 — CID 133186847
N-pentyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 133186847) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-pentyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | N-pentyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 133186847 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-pentyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CCCCCNC(=O)C(CC)Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H29NO2/c1-3-5-8-13-20-19(21)18(4-2)22-17-12-11-15-9-6-7-10-16(15)14-17/h11-12,14,18H,3-10,13H2,1-2H3,(H,20,21) |
| InChIKey | NCSTVLSSCDTQQP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|