C21H25NO2 — CID 100771364
(2R)-N-benzyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 100771364) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2R)-N-benzyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | (2R)-N-benzyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 100771364 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (2R)-N-benzyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CC[C@@H](Oc1ccc2c(c1)CCCC2)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-2-20(21(23)22-15-16-8-4-3-5-9-16)24-19-13-12-17-10-6-7-11-18(17)14-19/h3-5,8-9,12-14,20H,2,6-7,10-11,15H2,1H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | CLHJWICCQQBEIP-HXUWFJFHSA-N |
| XLogP | 4.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |