C23H29NO3 — CID 100549342
(2R)-N-[2-(2-methylphenoxy)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 100549342) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (2R)-N-[2-(2-methylphenoxy)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | (2R)-N-[2-(2-methylphenoxy)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 100549342 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2R)-N-[2-(2-methylphenoxy)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CC[C@@H](Oc1ccc2c(c1)CCCC2)C(=O)NCCOc1ccccc1C |
| InChI | InChI=1S/C23H29NO3/c1-3-21(27-20-13-12-18-9-5-6-10-19(18)16-20)23(25)24-14-15-26-22-11-7-4-8-17(22)2/h4,7-8,11-13,16,21H,3,5-6,9-10,14-15H2,1-2H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | AUEOTEAKGQHIHY-OAQYLSRUSA-N |
| XLogP | 4.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|