C22H27NO3 — CID 133164796
N-(2-phenoxyethyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 133164796) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | N-(2-phenoxyethyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 133164796 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-(2-phenoxyethyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)CCCC2)C(=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C22H27NO3/c1-2-21(22(24)23-14-15-25-19-10-4-3-5-11-19)26-20-13-12-17-8-6-7-9-18(17)16-20/h3-5,10-13,16,21H,2,6-9,14-15H2,1H3,(H,23,24) |
| InChIKey | PRKYPRPNBGMTES-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|