C22H27NO2 — CID 133161448
N-(2-phenylethyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 133161448) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | N-(2-phenylethyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 133161448 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-(2-phenylethyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)CCCC2)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C22H27NO2/c1-2-21(22(24)23-15-14-17-8-4-3-5-9-17)25-20-13-12-18-10-6-7-11-19(18)16-20/h3-5,8-9,12-13,16,21H,2,6-7,10-11,14-15H2,1H3,(H,23,24) |
| InChIKey | POSMGSQFXUJWGC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |