C28H31NO2 — CID 133202268
N,N-dibenzyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 133202268) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is N,N-dibenzyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | N,N-dibenzyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 133202268 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N,N-dibenzyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)CCCC2)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H31NO2/c1-2-27(31-26-18-17-24-15-9-10-16-25(24)19-26)28(30)29(20-22-11-5-3-6-12-22)21-23-13-7-4-8-14-23/h3-8,11-14,17-19,27H,2,9-10,15-16,20-21H2,1H3 |
| InChIKey | AZQNTEBJLAUZBH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |