C26H27NO2 — CID 100745817
(2R)-N-(2-phenylphenyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 100745817) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (2R)-N-(2-phenylphenyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | (2R)-N-(2-phenylphenyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 100745817 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2R)-N-(2-phenylphenyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CC[C@@H](Oc1ccc2c(c1)CCCC2)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H27NO2/c1-2-25(29-22-17-16-19-10-6-7-13-21(19)18-22)26(28)27-24-15-9-8-14-23(24)20-11-4-3-5-12-20/h3-5,8-9,11-12,14-18,25H,2,6-7,10,13H2,1H3,(H,27,28)/t25-/m1/s1 |
| InChIKey | IWBUTEURXIAQDB-RUZDIDTESA-N |
| XLogP | 6.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |