C24H28N2O3 — CID 133201842
N-prop-2-enyl-2-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoylamino]benzamide (PubChem CID 133201842) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-prop-2-enyl-2-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoylamino]benzamide.
| Compound Name | N-prop-2-enyl-2-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoylamino]benzamide |
|---|---|
| PubChem CID | 133201842 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-prop-2-enyl-2-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoylamino]benzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)C(CC)Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H28N2O3/c1-3-15-25-23(27)20-11-7-8-12-21(20)26-24(28)22(4-2)29-19-14-13-17-9-5-6-10-18(17)16-19/h3,7-8,11-14,16,22H,1,4-6,9-10,15H2,2H3,(H,25,27)(H,26,28) |
| InChIKey | QUXHRKMBVZQGOW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|