C24H24ClNO2 — CID 28575103
(2S)-N,N-dibenzyl-2-(2-chlorophenoxy)butanamide (PubChem CID 28575103) has the molecular formula C24H24ClNO2 and a molecular weight of 393.91 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-2-(2-chlorophenoxy)butanamide.
| Compound Name | (2S)-N,N-dibenzyl-2-(2-chlorophenoxy)butanamide |
|---|---|
| PubChem CID | 28575103 |
| Molecular Formula | C24H24ClNO2 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (2S)-N,N-dibenzyl-2-(2-chlorophenoxy)butanamide |
| SMILES | CC[C@H](Oc1ccccc1Cl)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H24ClNO2/c1-2-22(28-23-16-10-9-15-21(23)25)24(27)26(17-19-11-5-3-6-12-19)18-20-13-7-4-8-14-20/h3-16,22H,2,17-18H2,1H3/t22-/m0/s1 |
| InChIKey | UTDHDFOTCSVSLX-QFIPXVFZSA-N |
| XLogP | 5.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |