C24H31NO2S — CID 100576109
(2S)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 100576109) has the molecular formula C24H31NO2S and a molecular weight of 397.58 g/mol. Its IUPAC name is (2S)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | (2S)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 100576109 |
| Molecular Formula | C24H31NO2S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (2S)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CC[C@H](Oc1ccc2c(c1)CCCC2)C(=O)NCCSCc1ccccc1C |
| InChI | InChI=1S/C24H31NO2S/c1-3-23(27-22-13-12-19-9-6-7-10-20(19)16-22)24(26)25-14-15-28-17-21-11-5-4-8-18(21)2/h4-5,8,11-13,16,23H,3,6-7,9-10,14-15,17H2,1-2H3,(H,25,26)/t23-/m0/s1 |
| InChIKey | DIYGAWRWOPYHBB-QHCPKHFHSA-N |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|