C22H29NO2S — CID 94012140
(2S)-2-(3,4-dimethylphenoxy)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]butanamide (PubChem CID 94012140) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethylphenoxy)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]butanamide.
| Compound Name | (2S)-2-(3,4-dimethylphenoxy)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]butanamide |
|---|---|
| PubChem CID | 94012140 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2S)-2-(3,4-dimethylphenoxy)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]butanamide |
| SMILES | CC[C@H](Oc1ccc(C)c(C)c1)C(=O)NCCSCc1ccccc1C |
| InChI | InChI=1S/C22H29NO2S/c1-5-21(25-20-11-10-16(2)18(4)14-20)22(24)23-12-13-26-15-19-9-7-6-8-17(19)3/h6-11,14,21H,5,12-13,15H2,1-4H3,(H,23,24)/t21-/m0/s1 |
| InChIKey | HMTCUZLNBXDGFP-NRFANRHFSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|