C24H33NO2S — CID 132661123
2-(4-tert-butylphenoxy)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]butanamide (PubChem CID 132661123) has the molecular formula C24H33NO2S and a molecular weight of 399.60 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]butanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]butanamide |
|---|---|
| PubChem CID | 132661123 |
| Molecular Formula | C24H33NO2S |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]butanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)C)cc1)C(=O)NCCSCc1ccccc1C |
| InChI | InChI=1S/C24H33NO2S/c1-6-22(27-21-13-11-20(12-14-21)24(3,4)5)23(26)25-15-16-28-17-19-10-8-7-9-18(19)2/h7-14,22H,6,15-17H2,1-5H3,(H,25,26) |
| InChIKey | PRORWCRDYOTFPS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|