C21H27NO2S — CID 99954618
(2R)-N-(2-benzylsulfanylethyl)-2-(2,3-dimethylphenoxy)butanamide (PubChem CID 99954618) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is (2R)-N-(2-benzylsulfanylethyl)-2-(2,3-dimethylphenoxy)butanamide.
| Compound Name | (2R)-N-(2-benzylsulfanylethyl)-2-(2,3-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 99954618 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (2R)-N-(2-benzylsulfanylethyl)-2-(2,3-dimethylphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1cccc(C)c1C)C(=O)NCCSCc1ccccc1 |
| InChI | InChI=1S/C21H27NO2S/c1-4-19(24-20-12-8-9-16(2)17(20)3)21(23)22-13-14-25-15-18-10-6-5-7-11-18/h5-12,19H,4,13-15H2,1-3H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | HNILFITULPORAQ-LJQANCHMSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|