C20H25NO3S — CID 28579105
(2R)-N-(2-benzylsulfanylethyl)-2-(3-methoxyphenoxy)butanamide (PubChem CID 28579105) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (2R)-N-(2-benzylsulfanylethyl)-2-(3-methoxyphenoxy)butanamide.
| Compound Name | (2R)-N-(2-benzylsulfanylethyl)-2-(3-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 28579105 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2R)-N-(2-benzylsulfanylethyl)-2-(3-methoxyphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1cccc(OC)c1)C(=O)NCCSCc1ccccc1 |
| InChI | InChI=1S/C20H25NO3S/c1-3-19(24-18-11-7-10-17(14-18)23-2)20(22)21-12-13-25-15-16-8-5-4-6-9-16/h4-11,14,19H,3,12-13,15H2,1-2H3,(H,21,22)/t19-/m1/s1 |
| InChIKey | FVDMIMMMUVKJEC-LJQANCHMSA-N |
| XLogP | 3.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|