C16H25NO3 — CID 92683293
(2R)-2-(3-methoxyphenoxy)-N-pentylbutanamide (PubChem CID 92683293) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (2R)-2-(3-methoxyphenoxy)-N-pentylbutanamide.
| Compound Name | (2R)-2-(3-methoxyphenoxy)-N-pentylbutanamide |
|---|---|
| PubChem CID | 92683293 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (2R)-2-(3-methoxyphenoxy)-N-pentylbutanamide |
| SMILES | CCCCCNC(=O)[C@@H](CC)Oc1cccc(OC)c1 |
| InChI | InChI=1S/C16H25NO3/c1-4-6-7-11-17-16(18)15(5-2)20-14-10-8-9-13(12-14)19-3/h8-10,12,15H,4-7,11H2,1-3H3,(H,17,18)/t15-/m1/s1 |
| InChIKey | LEJGNWLURMEDTE-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|