C19H25NO2 — CID 92647112
(2S)-2-naphthalen-2-yloxy-N-pentylbutanamide (PubChem CID 92647112) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (2S)-2-naphthalen-2-yloxy-N-pentylbutanamide.
| Compound Name | (2S)-2-naphthalen-2-yloxy-N-pentylbutanamide |
|---|---|
| PubChem CID | 92647112 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (2S)-2-naphthalen-2-yloxy-N-pentylbutanamide |
| SMILES | CCCCCNC(=O)[C@H](CC)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H25NO2/c1-3-5-8-13-20-19(21)18(4-2)22-17-12-11-15-9-6-7-10-16(15)14-17/h6-7,9-12,14,18H,3-5,8,13H2,1-2H3,(H,20,21)/t18-/m0/s1 |
| InChIKey | JVVNRPUSYODFJD-SFHVURJKSA-N |
| XLogP | 4.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|