C28H40N2O4 — CID 3440313
2-phenoxy-N-[8-(2-phenoxybutanoylamino)octyl]butanamide (PubChem CID 3440313) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is 2-phenoxy-N-[8-(2-phenoxybutanoylamino)octyl]butanamide.
| Compound Name | 2-phenoxy-N-[8-(2-phenoxybutanoylamino)octyl]butanamide |
|---|---|
| PubChem CID | 3440313 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 2-phenoxy-N-[8-(2-phenoxybutanoylamino)octyl]butanamide |
| SMILES | CCC(Oc1ccccc1)C(=O)NCCCCCCCCNC(=O)C(CC)Oc1ccccc1 |
| InChI | InChI=1S/C28H40N2O4/c1-3-25(33-23-17-11-9-12-18-23)27(31)29-21-15-7-5-6-8-16-22-30-28(32)26(4-2)34-24-19-13-10-14-20-24/h9-14,17-20,25-26H,3-8,15-16,21-22H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | OYAIAHNBARPPST-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|