C40H48N2O4 — CID 17233430
2-(4-phenylphenoxy)-N-[8-[2-(4-phenylphenoxy)butanoylamino]octyl]butanamide (PubChem CID 17233430) has the molecular formula C40H48N2O4 and a molecular weight of 620.83 g/mol. Its IUPAC name is 2-(4-phenylphenoxy)-N-[8-[2-(4-phenylphenoxy)butanoylamino]octyl]butanamide.
| Compound Name | 2-(4-phenylphenoxy)-N-[8-[2-(4-phenylphenoxy)butanoylamino]octyl]butanamide |
|---|---|
| PubChem CID | 17233430 |
| Molecular Formula | C40H48N2O4 |
| Molecular Weight | 620.83 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | 2-(4-phenylphenoxy)-N-[8-[2-(4-phenylphenoxy)butanoylamino]octyl]butanamide |
| SMILES | CCC(Oc1ccc(-c2ccccc2)cc1)C(=O)NCCCCCCCCNC(=O)C(CC)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H48N2O4/c1-3-37(45-35-25-21-33(22-26-35)31-17-11-9-12-18-31)39(43)41-29-15-7-5-6-8-16-30-42-40(44)38(4-2)46-36-27-23-34(24-28-36)32-19-13-10-14-20-32/h9-14,17-28,37-38H,3-8,15-16,29-30H2,1-2H3,(H,41,43)(H,42,44) |
| InChIKey | MLMHQOUNGHIBSY-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.83 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|